C18H28BCl2N2O — CID 160953242
CID 160953242 (PubChem CID 160953242) has the molecular formula C18H28BCl2N2O and a molecular weight of 370.15 g/mol.
| Compound Name | CID 160953242 |
|---|---|
| PubChem CID | 160953242 |
| Molecular Formula | C18H28BCl2N2O |
| Molecular Weight | 370.15 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | — |
| SMILES | CC[C@H](Cc1cc(N(CCCl)CCCl)ccc1C(C)C)N[B]C=O |
| InChI | InChI=1S/C18H28BCl2N2O/c1-4-16(22-19-13-24)11-15-12-17(5-6-18(15)14(2)3)23(9-7-20)10-8-21/h5-6,12-14,16,22H,4,7-11H2,1-3H3/t16-/m1/s1 |
| InChIKey | PVRUHBFSTQVQET-MRXNPFEDSA-N |
| XLogP | 3.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.15 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|