C18H30Cl2N2 — CID 123209407
3-(2-amino-2,4-dimethylpentyl)-N,N-bis(2-chloroethyl)-4-methylaniline (PubChem CID 123209407) has the molecular formula C18H30Cl2N2 and a molecular weight of 345.36 g/mol. Its IUPAC name is 3-(2-amino-2,4-dimethylpentyl)-N,N-bis(2-chloroethyl)-4-methylaniline.
| Compound Name | 3-(2-amino-2,4-dimethylpentyl)-N,N-bis(2-chloroethyl)-4-methylaniline |
|---|---|
| PubChem CID | 123209407 |
| Molecular Formula | C18H30Cl2N2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-(2-amino-2,4-dimethylpentyl)-N,N-bis(2-chloroethyl)-4-methylaniline |
| SMILES | Cc1ccc(N(CCCl)CCCl)cc1CC(C)(N)CC(C)C |
| InChI | InChI=1S/C18H30Cl2N2/c1-14(2)12-18(4,21)13-16-11-17(6-5-15(16)3)22(9-7-19)10-8-20/h5-6,11,14H,7-10,12-13,21H2,1-4H3 |
| InChIKey | PUBFUXXNWTYKHY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|