C16H24BCl2N2O2 — CID 140770939
CID 140770939 (PubChem CID 140770939) has the molecular formula C16H24BCl2N2O2 and a molecular weight of 358.10 g/mol.
| Compound Name | CID 140770939 |
|---|---|
| PubChem CID | 140770939 |
| Molecular Formula | C16H24BCl2N2O2 |
| Molecular Weight | 358.10 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | — |
| SMILES | Cc1ccc(N(CCCl)CCCl)cc1C[C@@H](CCO)N[B]C=O |
| InChI | InChI=1S/C16H24BCl2N2O2/c1-13-2-3-16(21(7-5-18)8-6-19)11-14(13)10-15(4-9-22)20-17-12-23/h2-3,11-12,15,20,22H,4-10H2,1H3/t15-/m1/s1 |
| InChIKey | ATJDITUDNUHQFK-OAHLLOKOSA-N |
| XLogP | 1.97 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.10 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|