C35H91BN6O13Si9 — CID 160972335
CID 160972335 (PubChem CID 160972335) has the molecular formula C35H91BN6O13Si9 and a molecular weight of 1069.74 g/mol.
| Compound Name | CID 160972335 |
|---|---|
| PubChem CID | 160972335 |
| Molecular Formula | C35H91BN6O13Si9 |
| Molecular Weight | 1069.74 g/mol |
| Exact Mass | 1068.48 |
| IUPAC Name | — |
| SMILES | [2H]O[Si](C)(C)O[Si](C)(CCCNCCN)O[Si](C)(C)O[SiH](CN1CCOCC1)OC(C)(C)O[Si](CN1CCOCC1)(O[Si]([B])(C)C)O[Si](C)(C)O[Si](C)(CCCNCCN)O[Si](C)(C)O[2H] |
| InChI | InChI=1S/C35H91BN6O13Si9/c1-35(2,47-56(33-41-23-27-45-28-24-41)49-60(9,10)53-62(13,51-58(5,6)43)31-15-19-39-21-17-37)48-64(50-57(3,4)36,34-42-25-29-46-30-26-42)55-61(11,12)54-63(14,52-59(7,8)44)32-16-20-40-22-18-38/h39-40,43-44,56H,15-34,37-38H2,1-14H3/i43D,44D |
| InChIKey | KDFZRYKBIHBHBG-FMZUIYFCSA-N |
| XLogP | 1.46 |
| TPSA | 224.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1069.74 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|