C14H13NO6S2 — CID 160979569
2-[2-(2-oxo-3-phenyl-3-sulfopropyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 160979569) has the molecular formula C14H13NO6S2 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[2-(2-oxo-3-phenyl-3-sulfopropyl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(2-oxo-3-phenyl-3-sulfopropyl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 160979569 |
| Molecular Formula | C14H13NO6S2 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 2-[2-(2-oxo-3-phenyl-3-sulfopropyl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(CC(=O)C(c2ccccc2)S(=O)(=O)O)n1 |
| InChI | InChI=1S/C14H13NO6S2/c16-11(7-12-15-10(8-22-12)6-13(17)18)14(23(19,20)21)9-4-2-1-3-5-9/h1-5,8,14H,6-7H2,(H,17,18)(H,19,20,21) |
| InChIKey | SZIHJFCEIKOXDC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|