C22H23N5O9S — CID 161047872
[(2R,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[3-(3-oxo-1H-2-benzofuran-1-yl)propanoyl]sulfamate (PubChem CID 161047872) has the molecular formula C22H23N5O9S and a molecular weight of 533.52 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[3-(3-oxo-1H-2-benzofuran-1-yl)propanoyl]sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[3-(3-oxo-1H-2-benzofuran-1-yl)propanoyl]sulfamate |
|---|---|
| PubChem CID | 161047872 |
| Molecular Formula | C22H23N5O9S |
| Molecular Weight | 533.52 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[3-(3-oxo-1H-2-benzofuran-1-yl)propanoyl]sulfamate |
| SMILES | Nc1ccnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)CCC2OC(=O)c3ccccc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H23N5O9S/c23-13-7-8-24-20-17(13)25-10-27(20)21-19(30)18(29)15(35-21)9-34-37(32,33)26-16(28)6-5-14-11-3-1-2-4-12(11)22(31)36-14/h1-4,7-8,10,14-15,18-19,21,29-30H,5-6,9H2,(H2,23,24)(H,26,28)/t14?,15-,18-,19-,21-/m1/s1 |
| InChIKey | IPJOPXQDAYKMCR-FKLSPNDYSA-N |
| XLogP | -0.30 |
| TPSA | 205.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.52 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |