C44H55F9O7 — CID 161053118
(4-butan-2-ylphenyl)methyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate;2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol;[4-(1-hydroxycyclopentyl)phenyl] 2-methylbutanoate (PubChem CID 161053118) has the molecular formula C44H55F9O7 and a molecular weight of 866.90 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)methyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate;2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol;[4-(1-hydroxycyclopentyl)phenyl] 2-methylbutanoate.
| Compound Name | (4-butan-2-ylphenyl)methyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate;2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol;[4-(1-hydroxycyclopentyl)phenyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 161053118 |
| Molecular Formula | C44H55F9O7 |
| Molecular Weight | 866.90 g/mol |
| Exact Mass | 866.38 |
| IUPAC Name | (4-butan-2-ylphenyl)methyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate;2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol;[4-(1-hydroxycyclopentyl)phenyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)Oc1ccc(C2(O)CCCC2)cc1.CCC(C)c1ccc(C(C)(O)C(F)(F)F)cc1.CCC(C)c1ccc(COC(=O)C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H22O3.C15H16F6O3.C13H17F3O/c1-3-12(2)15(17)19-14-8-6-13(7-9-14)16(18)10-4-5-11-16;1-3-9(2)11-6-4-10(5-7-11)8-24-12(22)13(23,14(16,17)18)15(19,20)21;1-4-9(2)10-5-7-11(8-6-10)12(3,17)13(14,15)16/h6-9,12,18H,3-5,10-11H2,1-2H3;4-7,9,23H,3,8H2,1-2H3;5-9,17H,4H2,1-3H3 |
| InChIKey | UCJZFCAPWZVAAE-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.90 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|