C26H32F6O4 — CID 90208533
(4-butan-2-ylphenyl)methyl 2-(2-adamantyloxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate (PubChem CID 90208533) has the molecular formula C26H32F6O4 and a molecular weight of 522.53 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)methyl 2-(2-adamantyloxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate.
| Compound Name | (4-butan-2-ylphenyl)methyl 2-(2-adamantyloxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 90208533 |
| Molecular Formula | C26H32F6O4 |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | (4-butan-2-ylphenyl)methyl 2-(2-adamantyloxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
| SMILES | CCC(C)c1ccc(COC(=O)C(OCOC2C3CC4CC(C3)CC2C4)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H32F6O4/c1-3-15(2)19-6-4-16(5-7-19)13-34-23(33)24(25(27,28)29,26(30,31)32)36-14-35-22-20-9-17-8-18(11-20)12-21(22)10-17/h4-7,15,17-18,20-22H,3,8-14H2,1-2H3 |
| InChIKey | GYJREPRSZQTAHC-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|