About 1-methyl-1,3-azaphospholidine;1-methylpiperidine;pentan-2-one
1-methyl-1,3-azaphospholidine;1-methylpiperidine;pentan-2-one (PubChem CID 161067013) has the molecular formula C15H33N2OP
and a molecular weight of 288.42 g/mol. Its IUPAC name is 1-methyl-1,3-azaphospholidine;1-methylpiperidine;pentan-2-one.
Molecular Properties
| Compound Name | 1-methyl-1,3-azaphospholidine;1-methylpiperidine;pentan-2-one |
| PubChem CID | 161067013 |
| Molecular Formula | C15H33N2OP |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 1-methyl-1,3-azaphospholidine;1-methylpiperidine;pentan-2-one |
| SMILES | CCCC(C)=O.CN1CCCCC1.CN1CCPC1 |
| InChI | InChI=1S/C6H13N.C5H10O.C4H10NP/c1-7-5-3-2-4-6-7;1-3-4-5(2)6;1-5-2-3-6-4-5/h2-6H2,1H3;3-4H2,1-2H3;6H,2-4H2,1H3 |
| InChIKey | UEDRZEAVTYSHAZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1,3-azaphospholidine;1-methylpiperidine;pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1,3-azaphospholidine;1-methylpiperidine;pentan-2-one?
The IUPAC name of 1-methyl-1,3-azaphospholidine;1-methylpiperidine;pentan-2-one (CID 161067013) is 1-methyl-1,3-azaphospholidine;1-methylpiperidine;pentan-2-one.
What is the SMILES notation for 1-methyl-1,3-azaphospholidine;1-methylpiperidine;pentan-2-one?
The canonical SMILES for 1-methyl-1,3-azaphospholidine;1-methylpiperidine;pentan-2-one is CCCC(C)=O.CN1CCCCC1.CN1CCPC1.
What is the InChIKey of 1-methyl-1,3-azaphospholidine;1-methylpiperidine;pentan-2-one?
The InChIKey is UEDRZEAVTYSHAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C5H10O.C4H10NP/c1-7-5-3-2-4-6-7;1-3-4-5(2)6;1-5-2-3-6-4-5/h2-6H2,1H3;3-4H2,1-2H3;6H,2-4H2,1H3.
What are the key properties of 1-methyl-1,3-azaphospholidine;1-methylpiperidine;pentan-2-one?
1-methyl-1,3-azaphospholidine;1-methylpiperidine;pentan-2-one has a molecular weight of 288.42 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1,3-azaphospholidine;1-methylpiperidine;pentan-2-one is sourced from PubChem (CID 161067013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).