C69H47F3N6 — CID 161085347
2-[4-[2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,1,1-trifluoropropan-2-yl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 161085347) has the molecular formula C69H47F3N6 and a molecular weight of 1017.17 g/mol. Its IUPAC name is 2-[4-[2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,1,1-trifluoropropan-2-yl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,1,1-trifluoropropan-2-yl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 161085347 |
| Molecular Formula | C69H47F3N6 |
| Molecular Weight | 1017.17 g/mol |
| Exact Mass | 1016.38 |
| IUPAC Name | 2-[4-[2-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,1,1-trifluoropropan-2-yl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | CC(c1ccc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccc(-c4ccccc4)cc3)n2)cc1)(c1ccc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccc(-c4ccccc4)cc3)n2)cc1)C(F)(F)F |
| InChI | InChI=1S/C69H47F3N6/c1-68(69(70,71)72,60-42-38-58(39-43-60)66-75-62(54-30-22-50(23-31-54)46-14-6-2-7-15-46)73-63(76-66)55-32-24-51(25-33-55)47-16-8-3-9-17-47)61-44-40-59(41-45-61)67-77-64(56-34-26-52(27-35-56)48-18-10-4-11-19-48)74-65(78-67)57-36-28-53(29-37-57)49-20-12-5-13-21-49/h2-45H,1H3 |
| InChIKey | FXOJQDFFPVPPEA-UHFFFAOYSA-N |
| XLogP | 17.59 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.17 |
| LogP ≤ 5 | 17.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |