About 3-aminobenzenesulfonamide;isoquinoline
3-aminobenzenesulfonamide;isoquinoline (PubChem CID 161089636) has the molecular formula C15H15N3O2S
and a molecular weight of 301.37 g/mol. Its IUPAC name is 3-aminobenzenesulfonamide;isoquinoline.
Molecular Properties
| Compound Name | 3-aminobenzenesulfonamide;isoquinoline |
| PubChem CID | 161089636 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-aminobenzenesulfonamide;isoquinoline |
| SMILES | Nc1cccc(S(N)(=O)=O)c1.c1ccc2cnccc2c1 |
| InChI | InChI=1S/C9H7N.C6H8N2O2S/c1-2-4-9-7-10-6-5-8(9)3-1;7-5-2-1-3-6(4-5)11(8,9)10/h1-7H;1-4H,7H2,(H2,8,9,10) |
| InChIKey | UGZQLUAEJAXCAZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobenzenesulfonamide;isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobenzenesulfonamide;isoquinoline?
The IUPAC name of 3-aminobenzenesulfonamide;isoquinoline (CID 161089636) is 3-aminobenzenesulfonamide;isoquinoline.
What is the SMILES notation for 3-aminobenzenesulfonamide;isoquinoline?
The canonical SMILES for 3-aminobenzenesulfonamide;isoquinoline is Nc1cccc(S(N)(=O)=O)c1.c1ccc2cnccc2c1.
What is the InChIKey of 3-aminobenzenesulfonamide;isoquinoline?
The InChIKey is UGZQLUAEJAXCAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C6H8N2O2S/c1-2-4-9-7-10-6-5-8(9)3-1;7-5-2-1-3-6(4-5)11(8,9)10/h1-7H;1-4H,7H2,(H2,8,9,10).
What are the key properties of 3-aminobenzenesulfonamide;isoquinoline?
3-aminobenzenesulfonamide;isoquinoline has a molecular weight of 301.37 g/mol, XLogP of 2.15, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobenzenesulfonamide;isoquinoline is sourced from PubChem (CID 161089636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).