C36H42N2O2P2 — CID 161151389
(2R,5S)-N,N-dimethyl-1-oxo-2,5-diphenyl-2,5-dihydro-1λ5-phosphol-1-amine;(2S,5R)-N,N-dimethyl-1-oxo-2,5-diphenyl-1λ5-phospholan-1-amine (PubChem CID 161151389) has the molecular formula C36H42N2O2P2 and a molecular weight of 596.69 g/mol. Its IUPAC name is (2R,5S)-N,N-dimethyl-1-oxo-2,5-diphenyl-2,5-dihydro-1λ5-phosphol-1-amine;(2S,5R)-N,N-dimethyl-1-oxo-2,5-diphenyl-1λ5-phospholan-1-amine.
| Compound Name | (2R,5S)-N,N-dimethyl-1-oxo-2,5-diphenyl-2,5-dihydro-1λ5-phosphol-1-amine;(2S,5R)-N,N-dimethyl-1-oxo-2,5-diphenyl-1λ5-phospholan-1-amine |
|---|---|
| PubChem CID | 161151389 |
| Molecular Formula | C36H42N2O2P2 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | (2R,5S)-N,N-dimethyl-1-oxo-2,5-diphenyl-2,5-dihydro-1λ5-phosphol-1-amine;(2S,5R)-N,N-dimethyl-1-oxo-2,5-diphenyl-1λ5-phospholan-1-amine |
| SMILES | CN(C)P1(=O)[C@@H](c2ccccc2)C=C[C@H]1c1ccccc1.CN(C)P1(=O)[C@@H](c2ccccc2)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H22NOP.C18H20NOP/c2*1-19(2)21(20)17(15-9-5-3-6-10-15)13-14-18(21)16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3;3-14,17-18H,1-2H3/t2*17-,18+,21? |
| InChIKey | UOSLMSBNZCKJKR-WDRJFKBLSA-N |
| XLogP | 9.98 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|