C13H11N3 — CID 161207252
1,3,16-triazatricyclo[9.5.0.02,7]hexadeca-2(7),3,5,8,10,12,14-heptaene (PubChem CID 161207252) has the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 1,3,16-triazatricyclo[9.5.0.02,7]hexadeca-2(7),3,5,8,10,12,14-heptaene.
| Compound Name | 1,3,16-triazatricyclo[9.5.0.02,7]hexadeca-2(7),3,5,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 161207252 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1,3,16-triazatricyclo[9.5.0.02,7]hexadeca-2(7),3,5,8,10,12,14-heptaene |
| SMILES | c1ccc2cccc3cccnc3n-2[nH]c1 |
| InChI | InChI=1S/C13H11N3/c1-2-10-15-16-12(7-1)8-3-5-11-6-4-9-14-13(11)16/h1-10,15H |
| InChIKey | UVTPRPLLFVAQHN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |