About 9H-fluorene;1H-pyrazol-5-amine
9H-fluorene;1H-pyrazol-5-amine (PubChem CID 161271252) has the molecular formula C16H15N3
and a molecular weight of 249.32 g/mol. Its IUPAC name is 9H-fluorene;1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | 9H-fluorene;1H-pyrazol-5-amine |
| PubChem CID | 161271252 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 9H-fluorene;1H-pyrazol-5-amine |
| SMILES | Nc1ccn[nH]1.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C3H5N3/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;4-3-1-2-5-6-3/h1-8H,9H2;1-2H,(H3,4,5,6) |
| InChIKey | VDVQDPPURYMKBZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-fluorene;1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;1H-pyrazol-5-amine?
The IUPAC name of 9H-fluorene;1H-pyrazol-5-amine (CID 161271252) is 9H-fluorene;1H-pyrazol-5-amine.
What is the SMILES notation for 9H-fluorene;1H-pyrazol-5-amine?
The canonical SMILES for 9H-fluorene;1H-pyrazol-5-amine is Nc1ccn[nH]1.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;1H-pyrazol-5-amine?
The InChIKey is VDVQDPPURYMKBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C3H5N3/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;4-3-1-2-5-6-3/h1-8H,9H2;1-2H,(H3,4,5,6).
What are the key properties of 9H-fluorene;1H-pyrazol-5-amine?
9H-fluorene;1H-pyrazol-5-amine has a molecular weight of 249.32 g/mol, XLogP of 3.25, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;1H-pyrazol-5-amine is sourced from PubChem (CID 161271252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).