C39H55F8NO13S4 — CID 161304354
2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonic acid;2,5-dicyclohexylbenzenesulfonic acid;1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropane-1-sulfonic acid (PubChem CID 161304354) has the molecular formula C39H55F8NO13S4 and a molecular weight of 1026.11 g/mol. Its IUPAC name is 2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonic acid;2,5-dicyclohexylbenzenesulfonic acid;1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropane-1-sulfonic acid.
| Compound Name | 2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonic acid;2,5-dicyclohexylbenzenesulfonic acid;1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 161304354 |
| Molecular Formula | C39H55F8NO13S4 |
| Molecular Weight | 1026.11 g/mol |
| Exact Mass | 1025.24 |
| IUPAC Name | 2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonic acid;2,5-dicyclohexylbenzenesulfonic acid;1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonylpropane-1-sulfonic acid |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)C(F)(F)S(=O)(=O)O.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCCC1.O=S(=O)(O)c1cc(C2CCCCC2)ccc1C1CCCCC1 |
| InChI | InChI=1S/C18H26O3S.C13H18F2O5S.C8H11F6NO5S2/c19-22(20,21)18-13-16(14-7-3-1-4-8-14)11-12-17(18)15-9-5-2-6-10-15;14-13(15,21(17,18)19)11(16)20-7-12-4-8-1-9(5-12)3-10(2-8)6-12;9-6(10,8(13,14)22(18,19)20)7(11,12)21(16,17)15-4-2-1-3-5-15/h11-15H,1-10H2,(H,19,20,21);8-10H,1-7H2,(H,17,18,19);1-5H2,(H,18,19,20) |
| InChIKey | VIAWVWSWGBUZGX-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 226.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1026.11 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|