C9H2F18 — CID 161312704
1,1,1,2,2,2-hexafluoroethane;(E)-1,1,1,3,4,5,5,5-octafluoro-2-(fluoromethyl)-4-(trifluoromethyl)pent-2-ene (PubChem CID 161312704) has the molecular formula C9H2F18 and a molecular weight of 452.08 g/mol. Its IUPAC name is 1,1,1,2,2,2-hexafluoroethane;(E)-1,1,1,3,4,5,5,5-octafluoro-2-(fluoromethyl)-4-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,2,2,2-hexafluoroethane;(E)-1,1,1,3,4,5,5,5-octafluoro-2-(fluoromethyl)-4-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 161312704 |
| Molecular Formula | C9H2F18 |
| Molecular Weight | 452.08 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 1,1,1,2,2,2-hexafluoroethane;(E)-1,1,1,3,4,5,5,5-octafluoro-2-(fluoromethyl)-4-(trifluoromethyl)pent-2-ene |
| SMILES | FC(F)(F)C(F)(F)F.FC/C(=C(\F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H2F12.C2F6/c8-1-2(5(11,12)13)3(9)4(10,6(14,15)16)7(17,18)19;3-1(4,5)2(6,7)8/h1H2;/b3-2+; |
| InChIKey | VJCGKGZRZATBRW-SQQVDAMQSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.08 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|