C15H9F4Y- — CID 161322945
1,2,3,4-tetrafluoro-10-methyl-9,10-dihydrophenanthren-9-ide;yttrium (PubChem CID 161322945) has the molecular formula C15H9F4Y- and a molecular weight of 354.14 g/mol. Its IUPAC name is 1,2,3,4-tetrafluoro-10-methyl-9,10-dihydrophenanthren-9-ide;yttrium.
| Compound Name | 1,2,3,4-tetrafluoro-10-methyl-9,10-dihydrophenanthren-9-ide;yttrium |
|---|---|
| PubChem CID | 161322945 |
| Molecular Formula | C15H9F4Y- |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 1,2,3,4-tetrafluoro-10-methyl-9,10-dihydrophenanthren-9-ide;yttrium |
| SMILES | CC1[CH-]c2ccccc2-c2c(F)c(F)c(F)c(F)c21.[Y] |
| InChI | InChI=1S/C15H9F4.Y/c1-7-6-8-4-2-3-5-9(8)11-10(7)12(16)14(18)15(19)13(11)17;/h2-7H,1H3;/q-1; |
| InChIKey | CORWOFYSTCEPHS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|