C23H18O6 — CID 161325544
4-[(2,4-dihydroxyphenyl)methyl]benzene-1,3-diol;naphthalene-1,2-dione (PubChem CID 161325544) has the molecular formula C23H18O6 and a molecular weight of 390.39 g/mol. Its IUPAC name is 4-[(2,4-dihydroxyphenyl)methyl]benzene-1,3-diol;naphthalene-1,2-dione.
| Compound Name | 4-[(2,4-dihydroxyphenyl)methyl]benzene-1,3-diol;naphthalene-1,2-dione |
|---|---|
| PubChem CID | 161325544 |
| Molecular Formula | C23H18O6 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 4-[(2,4-dihydroxyphenyl)methyl]benzene-1,3-diol;naphthalene-1,2-dione |
| SMILES | O=C1C=Cc2ccccc2C1=O.Oc1ccc(Cc2ccc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C13H12O4.C10H6O2/c14-10-3-1-8(12(16)6-10)5-9-2-4-11(15)7-13(9)17;11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-4,6-7,14-17H,5H2;1-6H |
| InChIKey | VKSHYNLDHBGQCD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|