C33H24O9 — CID 161358558
(E)-3-(3-hydroxy-6-methylidenexanthen-9-yl)prop-2-enoic acid;3-(3-hydroxy-6-oxoxanthen-9-yl)propanoic acid (PubChem CID 161358558) has the molecular formula C33H24O9 and a molecular weight of 564.55 g/mol. Its IUPAC name is (E)-3-(3-hydroxy-6-methylidenexanthen-9-yl)prop-2-enoic acid;3-(3-hydroxy-6-oxoxanthen-9-yl)propanoic acid.
| Compound Name | (E)-3-(3-hydroxy-6-methylidenexanthen-9-yl)prop-2-enoic acid;3-(3-hydroxy-6-oxoxanthen-9-yl)propanoic acid |
|---|---|
| PubChem CID | 161358558 |
| Molecular Formula | C33H24O9 |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | (E)-3-(3-hydroxy-6-methylidenexanthen-9-yl)prop-2-enoic acid;3-(3-hydroxy-6-oxoxanthen-9-yl)propanoic acid |
| SMILES | C=c1ccc2c(c1)Oc1cc(O)ccc1C=2/C=C/C(=O)O.O=C(O)CCc1c2ccc(=O)cc-2oc2cc(O)ccc12 |
| InChI | InChI=1S/C17H12O4.C16H12O5/c1-10-2-4-13-12(6-7-17(19)20)14-5-3-11(18)9-16(14)21-15(13)8-10;17-9-1-3-12-11(5-6-16(19)20)13-4-2-10(18)8-15(13)21-14(12)7-9/h2-9,18H,1H2,(H,19,20);1-4,7-8,17H,5-6H2,(H,19,20)/b7-6+; |
| InChIKey | VOWDPJFGQBICAL-UHDJGPCESA-N |
| XLogP | 4.37 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|