C18H18ClN7 — CID 161419822
1-(4-chloro-3-methylphenyl)-2-[4-methyl-6-(pyridin-4-ylamino)pyrimidin-2-yl]guanidine (PubChem CID 161419822) has the molecular formula C18H18ClN7 and a molecular weight of 367.84 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenyl)-2-[4-methyl-6-(pyridin-4-ylamino)pyrimidin-2-yl]guanidine.
| Compound Name | 1-(4-chloro-3-methylphenyl)-2-[4-methyl-6-(pyridin-4-ylamino)pyrimidin-2-yl]guanidine |
|---|---|
| PubChem CID | 161419822 |
| Molecular Formula | C18H18ClN7 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-(4-chloro-3-methylphenyl)-2-[4-methyl-6-(pyridin-4-ylamino)pyrimidin-2-yl]guanidine |
| SMILES | Cc1cc(Nc2ccncc2)nc(N=C(N)Nc2ccc(Cl)c(C)c2)n1 |
| InChI | InChI=1S/C18H18ClN7/c1-11-9-14(3-4-15(11)19)24-17(20)26-18-22-12(2)10-16(25-18)23-13-5-7-21-8-6-13/h3-10H,1-2H3,(H4,20,21,22,23,24,25,26) |
| InChIKey | IAWYKNFFAPHOMV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 101.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|