C50H58N6O12 — CID 161437158
furan-2,5-dione;styrene;triamino 4,8,12-tricarbamoyl-5,9,13-triphenyltetradecane-2,6,10-tricarboxylate (PubChem CID 161437158) has the molecular formula C50H58N6O12 and a molecular weight of 935.04 g/mol. Its IUPAC name is furan-2,5-dione;styrene;triamino 4,8,12-tricarbamoyl-5,9,13-triphenyltetradecane-2,6,10-tricarboxylate.
| Compound Name | furan-2,5-dione;styrene;triamino 4,8,12-tricarbamoyl-5,9,13-triphenyltetradecane-2,6,10-tricarboxylate |
|---|---|
| PubChem CID | 161437158 |
| Molecular Formula | C50H58N6O12 |
| Molecular Weight | 935.04 g/mol |
| Exact Mass | 934.41 |
| IUPAC Name | furan-2,5-dione;styrene;triamino 4,8,12-tricarbamoyl-5,9,13-triphenyltetradecane-2,6,10-tricarboxylate |
| SMILES | C=Cc1ccccc1.CCC(C(=O)ON)C(C(N)=O)C(CC(C(=O)ON)C(C(N)=O)C(CC(C(=O)ON)C(C(N)=O)C(C)c1ccccc1)c1ccccc1)c1ccccc1.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C38H48N6O9.C8H8.C4H2O3/c1-3-25(36(48)51-42)31(34(40)46)26(23-15-9-5-10-16-23)20-29(38(50)53-44)32(35(41)47)27(24-17-11-6-12-18-24)19-28(37(49)52-43)30(33(39)45)21(2)22-13-7-4-8-14-22;1-2-8-6-4-3-5-7-8;5-3-1-2-4(6)7-3/h4-18,21,25-32H,3,19-20,42-44H2,1-2H3,(H2,39,45)(H2,40,46)(H2,41,47);2-7H,1H2;1-2H |
| InChIKey | VYUIZELAGVNEJU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 329.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.04 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|