About dimethyl-(oxiran-2-ylmethoxy)-phenylsilane;oxiran-2-ylmethanol
dimethyl-(oxiran-2-ylmethoxy)-phenylsilane;oxiran-2-ylmethanol (PubChem CID 161439221) has the molecular formula C14H22O4Si
and a molecular weight of 282.41 g/mol. Its IUPAC name is dimethyl-(oxiran-2-ylmethoxy)-phenylsilane;oxiran-2-ylmethanol.
Molecular Properties
| Compound Name | dimethyl-(oxiran-2-ylmethoxy)-phenylsilane;oxiran-2-ylmethanol |
| PubChem CID | 161439221 |
| Molecular Formula | C14H22O4Si |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | dimethyl-(oxiran-2-ylmethoxy)-phenylsilane;oxiran-2-ylmethanol |
| SMILES | C[Si](C)(OCC1CO1)c1ccccc1.OCC1CO1 |
| InChI | InChI=1S/C11H16O2Si.C3H6O2/c1-14(2,13-9-10-8-12-10)11-6-4-3-5-7-11;4-1-3-2-5-3/h3-7,10H,8-9H2,1-2H3;3-4H,1-2H2 |
| InChIKey | VZAYGMOGFIKKIU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-(oxiran-2-ylmethoxy)-phenylsilane;oxiran-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-(oxiran-2-ylmethoxy)-phenylsilane;oxiran-2-ylmethanol?
The IUPAC name of dimethyl-(oxiran-2-ylmethoxy)-phenylsilane;oxiran-2-ylmethanol (CID 161439221) is dimethyl-(oxiran-2-ylmethoxy)-phenylsilane;oxiran-2-ylmethanol.
What is the SMILES notation for dimethyl-(oxiran-2-ylmethoxy)-phenylsilane;oxiran-2-ylmethanol?
The canonical SMILES for dimethyl-(oxiran-2-ylmethoxy)-phenylsilane;oxiran-2-ylmethanol is C[Si](C)(OCC1CO1)c1ccccc1.OCC1CO1.
What is the InChIKey of dimethyl-(oxiran-2-ylmethoxy)-phenylsilane;oxiran-2-ylmethanol?
The InChIKey is VZAYGMOGFIKKIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2Si.C3H6O2/c1-14(2,13-9-10-8-12-10)11-6-4-3-5-7-11;4-1-3-2-5-3/h3-7,10H,8-9H2,1-2H3;3-4H,1-2H2.
What are the key properties of dimethyl-(oxiran-2-ylmethoxy)-phenylsilane;oxiran-2-ylmethanol?
dimethyl-(oxiran-2-ylmethoxy)-phenylsilane;oxiran-2-ylmethanol has a molecular weight of 282.41 g/mol, XLogP of 0.89, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-(oxiran-2-ylmethoxy)-phenylsilane;oxiran-2-ylmethanol is sourced from PubChem (CID 161439221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).