C28H39N6O6PSi — CID 161457778
N-[9-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-cyanoethoxy(methyl)phosphanyl]oxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]purin-6-yl]benzamide (PubChem CID 161457778) has the molecular formula C28H39N6O6PSi and a molecular weight of 614.72 g/mol. Its IUPAC name is N-[9-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-cyanoethoxy(methyl)phosphanyl]oxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-cyanoethoxy(methyl)phosphanyl]oxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 161457778 |
| Molecular Formula | C28H39N6O6PSi |
| Molecular Weight | 614.72 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | N-[9-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[2-cyanoethoxy(methyl)phosphanyl]oxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CP(OCCC#N)OC1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@]1(C)CO |
| InChI | InChI=1S/C28H39N6O6PSi/c1-27(2,3)42(6,7)40-21-22(39-41(5)37-15-11-14-29)28(4,16-35)38-26(21)34-18-32-20-23(30-17-31-24(20)34)33-25(36)19-12-9-8-10-13-19/h8-10,12-13,17-18,21-22,26,35H,11,15-16H2,1-7H3,(H,30,31,33,36)/t21-,22?,26+,28+,41?/m0/s1 |
| InChIKey | MPKCNDAHNDUIMP-WUSOMFNVSA-N |
| XLogP | 5.01 |
| TPSA | 153.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.72 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|