C20H20Cl10N2O4 — CID 161468922
4-butoxy-3,5-dichloro-2-methoxy-6-(trichloromethyl)pyridine;3,5-dichloro-4-ethoxy-2-methoxy-6-(trichloromethyl)pyridine (PubChem CID 161468922) has the molecular formula C20H20Cl10N2O4 and a molecular weight of 706.92 g/mol. Its IUPAC name is 4-butoxy-3,5-dichloro-2-methoxy-6-(trichloromethyl)pyridine;3,5-dichloro-4-ethoxy-2-methoxy-6-(trichloromethyl)pyridine.
| Compound Name | 4-butoxy-3,5-dichloro-2-methoxy-6-(trichloromethyl)pyridine;3,5-dichloro-4-ethoxy-2-methoxy-6-(trichloromethyl)pyridine |
|---|---|
| PubChem CID | 161468922 |
| Molecular Formula | C20H20Cl10N2O4 |
| Molecular Weight | 706.92 g/mol |
| Exact Mass | 701.83 |
| IUPAC Name | 4-butoxy-3,5-dichloro-2-methoxy-6-(trichloromethyl)pyridine;3,5-dichloro-4-ethoxy-2-methoxy-6-(trichloromethyl)pyridine |
| SMILES | CCCCOc1c(Cl)c(OC)nc(C(Cl)(Cl)Cl)c1Cl.CCOc1c(Cl)c(OC)nc(C(Cl)(Cl)Cl)c1Cl |
| InChI | InChI=1S/C11H12Cl5NO2.C9H8Cl5NO2/c1-3-4-5-19-8-6(12)9(11(14,15)16)17-10(18-2)7(8)13;1-3-17-6-4(10)7(9(12,13)14)15-8(16-2)5(6)11/h3-5H2,1-2H3;3H2,1-2H3 |
| InChIKey | WCURKXMUOFBNEP-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.92 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|