About butan-2-one;sulfamic acid;hydrochloride
butan-2-one;sulfamic acid;hydrochloride (PubChem CID 161477888) has the molecular formula C4H12ClNO4S
and a molecular weight of 205.66 g/mol. Its IUPAC name is butan-2-one;sulfamic acid;hydrochloride.
Molecular Properties
| Compound Name | butan-2-one;sulfamic acid;hydrochloride |
| PubChem CID | 161477888 |
| Molecular Formula | C4H12ClNO4S |
| Molecular Weight | 205.66 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | butan-2-one;sulfamic acid;hydrochloride |
| SMILES | CCC(C)=O.Cl.NS(=O)(=O)O |
| InChI | InChI=1S/C4H8O.ClH.H3NO3S/c1-3-4(2)5;;1-5(2,3)4/h3H2,1-2H3;1H;(H3,1,2,3,4) |
| InChIKey | WDYOVZNHLGNAJN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.66 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;sulfamic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;sulfamic acid;hydrochloride?
The IUPAC name of butan-2-one;sulfamic acid;hydrochloride (CID 161477888) is butan-2-one;sulfamic acid;hydrochloride.
What is the SMILES notation for butan-2-one;sulfamic acid;hydrochloride?
The canonical SMILES for butan-2-one;sulfamic acid;hydrochloride is CCC(C)=O.Cl.NS(=O)(=O)O.
What is the InChIKey of butan-2-one;sulfamic acid;hydrochloride?
The InChIKey is WDYOVZNHLGNAJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.ClH.H3NO3S/c1-3-4(2)5;;1-5(2,3)4/h3H2,1-2H3;1H;(H3,1,2,3,4).
What are the key properties of butan-2-one;sulfamic acid;hydrochloride?
butan-2-one;sulfamic acid;hydrochloride has a molecular weight of 205.66 g/mol, XLogP of 0.16, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;sulfamic acid;hydrochloride is sourced from PubChem (CID 161477888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).