C41H37N5O8 — CID 161478949
4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;4-(6,7-dimethoxyquinolin-4-yl)oxy-N-[(2-nitrophenyl)methyl]cyclohexa-2,4-dien-1-imine (PubChem CID 161478949) has the molecular formula C41H37N5O8 and a molecular weight of 727.77 g/mol. Its IUPAC name is 4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;4-(6,7-dimethoxyquinolin-4-yl)oxy-N-[(2-nitrophenyl)methyl]cyclohexa-2,4-dien-1-imine.
| Compound Name | 4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;4-(6,7-dimethoxyquinolin-4-yl)oxy-N-[(2-nitrophenyl)methyl]cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 161478949 |
| Molecular Formula | C41H37N5O8 |
| Molecular Weight | 727.77 g/mol |
| Exact Mass | 727.26 |
| IUPAC Name | 4-(6,7-dimethoxyquinolin-4-yl)oxyaniline;4-(6,7-dimethoxyquinolin-4-yl)oxy-N-[(2-nitrophenyl)methyl]cyclohexa-2,4-dien-1-imine |
| SMILES | COc1cc2nccc(OC3=CC/C(=N/Cc4ccccc4[N+](=O)[O-])C=C3)c2cc1OC.COc1cc2nccc(Oc3ccc(N)cc3)c2cc1OC |
| InChI | InChI=1S/C24H21N3O5.C17H16N2O3/c1-30-23-13-19-20(14-24(23)31-2)25-12-11-22(19)32-18-9-7-17(8-10-18)26-15-16-5-3-4-6-21(16)27(28)29;1-20-16-9-13-14(10-17(16)21-2)19-8-7-15(13)22-12-5-3-11(18)4-6-12/h3-7,9-14H,8,15H2,1-2H3;3-10H,18H2,1-2H3/b26-17+; |
| InChIKey | WECALWXSNXIRQK-VOGLITBBSA-N |
| XLogP | 8.65 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.77 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|