C27H34N8O12S2 — CID 161498177
[(2S,5R)-2-(anilinocarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;[(2S,5R)-2-[(N-methylanilino)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 161498177) has the molecular formula C27H34N8O12S2 and a molecular weight of 726.75 g/mol. Its IUPAC name is [(2S,5R)-2-(anilinocarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;[(2S,5R)-2-[(N-methylanilino)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-(anilinocarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;[(2S,5R)-2-[(N-methylanilino)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 161498177 |
| Molecular Formula | C27H34N8O12S2 |
| Molecular Weight | 726.75 g/mol |
| Exact Mass | 726.17 |
| IUPAC Name | [(2S,5R)-2-(anilinocarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;[(2S,5R)-2-[(N-methylanilino)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CN(NC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O)c1ccccc1.O=C(NNc1ccccc1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C14H18N4O6S.C13H16N4O6S/c1-16(10-5-3-2-4-6-10)15-13(19)12-8-7-11-9-17(12)14(20)18(11)24-25(21,22)23;18-12(15-14-9-4-2-1-3-5-9)11-7-6-10-8-16(11)13(19)17(10)23-24(20,21)22/h2-6,11-12H,7-9H2,1H3,(H,15,19)(H,21,22,23);1-5,10-11,14H,6-8H2,(H,15,18)(H,20,21,22)/t11-,12+;10-,11+/m11/s1 |
| InChIKey | WGMJSDYLMMIERO-FRFSKTEMSA-N |
| XLogP | 0.29 |
| TPSA | 247.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.75 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|