C27H45NO7 — CID 162098503
(1R,2R,3aS,9aS)-1-[(3S)-3-hydroxyoctyl]-5-methoxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-2-ol;carbon dioxide;2-(2-hydroxyethylamino)ethanol (PubChem CID 162098503) has the molecular formula C27H45NO7 and a molecular weight of 495.66 g/mol. Its IUPAC name is (1R,2R,3aS,9aS)-1-[(3S)-3-hydroxyoctyl]-5-methoxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-2-ol;carbon dioxide;2-(2-hydroxyethylamino)ethanol.
| Compound Name | (1R,2R,3aS,9aS)-1-[(3S)-3-hydroxyoctyl]-5-methoxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-2-ol;carbon dioxide;2-(2-hydroxyethylamino)ethanol |
|---|---|
| PubChem CID | 162098503 |
| Molecular Formula | C27H45NO7 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | (1R,2R,3aS,9aS)-1-[(3S)-3-hydroxyoctyl]-5-methoxy-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]naphthalen-2-ol;carbon dioxide;2-(2-hydroxyethylamino)ethanol |
| SMILES | CCCCC[C@H](O)CC[C@@H]1[C@H]2Cc3cccc(OC)c3C[C@H]2C[C@H]1O.O=C=O.OCCNCCO |
| InChI | InChI=1S/C22H34O3.C4H11NO2.CO2/c1-3-4-5-8-17(23)10-11-18-19-12-15-7-6-9-22(25-2)20(15)13-16(19)14-21(18)24;6-3-1-5-2-4-7;2-1-3/h6-7,9,16-19,21,23-24H,3-5,8,10-14H2,1-2H3;5-7H,1-4H2;/t16-,17-,18+,19-,21+;;/m0../s1 |
| InChIKey | ZEOKKSCGFVKATQ-DSGPYVBMSA-N |
| XLogP | 2.11 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|