C26H24F4O5S2 — CID 162117852
6,6,7,7-tetrafluoro-2-methyl-7-sulfohept-2-enoate;triphenylsulfanium (PubChem CID 162117852) has the molecular formula C26H24F4O5S2 and a molecular weight of 556.60 g/mol. Its IUPAC name is 6,6,7,7-tetrafluoro-2-methyl-7-sulfohept-2-enoate;triphenylsulfanium.
| Compound Name | 6,6,7,7-tetrafluoro-2-methyl-7-sulfohept-2-enoate;triphenylsulfanium |
|---|---|
| PubChem CID | 162117852 |
| Molecular Formula | C26H24F4O5S2 |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | 6,6,7,7-tetrafluoro-2-methyl-7-sulfohept-2-enoate;triphenylsulfanium |
| SMILES | CC(=CCCC(F)(F)C(F)(F)S(=O)(=O)O)C(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C8H10F4O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5(6(13)14)3-2-4-7(9,10)8(11,12)18(15,16)17/h1-15H;3H,2,4H2,1H3,(H,13,14)(H,15,16,17)/q+1;/p-1 |
| InChIKey | ZGZWCFHNYTYVGI-UHFFFAOYSA-M |
| XLogP | 5.36 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|