C14H23NO — CID 162119305
1-[[(3R)-2-cyclopropylpent-1-en-3-yl]-methylamino]pent-3-en-2-one (PubChem CID 162119305) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-[[(3R)-2-cyclopropylpent-1-en-3-yl]-methylamino]pent-3-en-2-one.
| Compound Name | 1-[[(3R)-2-cyclopropylpent-1-en-3-yl]-methylamino]pent-3-en-2-one |
|---|---|
| PubChem CID | 162119305 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-[[(3R)-2-cyclopropylpent-1-en-3-yl]-methylamino]pent-3-en-2-one |
| SMILES | C=C(C1CC1)[C@@H](CC)N(C)CC(=O)C=CC |
| InChI | InChI=1S/C14H23NO/c1-5-7-13(16)10-15(4)14(6-2)11(3)12-8-9-12/h5,7,12,14H,3,6,8-10H2,1-2,4H3/t14-/m1/s1 |
| InChIKey | ZHESKHZPGRQVRQ-CQSZACIVSA-N |
| XLogP | 2.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|