C28H32N4 — CID 162212594
azane;2,3-diphenylaziridine;(1R,2R)-1,2-diphenylethane-1,2-diamine (PubChem CID 162212594) has the molecular formula C28H32N4 and a molecular weight of 424.59 g/mol. Its IUPAC name is azane;2,3-diphenylaziridine;(1R,2R)-1,2-diphenylethane-1,2-diamine.
| Compound Name | azane;2,3-diphenylaziridine;(1R,2R)-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 162212594 |
| Molecular Formula | C28H32N4 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | azane;2,3-diphenylaziridine;(1R,2R)-1,2-diphenylethane-1,2-diamine |
| SMILES | N.N[C@H](c1ccccc1)[C@H](N)c1ccccc1.c1ccc(C2NC2c2ccccc2)cc1 |
| InChI | InChI=1S/C14H16N2.C14H13N.H3N/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-3-7-11(8-4-1)13-14(15-13)12-9-5-2-6-10-12;/h1-10,13-14H,15-16H2;1-10,13-15H;1H3/t13-,14-;;/m1../s1 |
| InChIKey | RYDUARRHHSGXBV-KFWOVWKUSA-N |
| XLogP | 5.62 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|