About 2-[2-(2-hydroxyethyl)-1H-imidazol-5-yl]acetic acid;quinoline
2-[2-(2-hydroxyethyl)-1H-imidazol-5-yl]acetic acid;quinoline (PubChem CID 162245224) has the molecular formula C16H17N3O3
and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethyl)-1H-imidazol-5-yl]acetic acid;quinoline.
Molecular Properties
| Compound Name | 2-[2-(2-hydroxyethyl)-1H-imidazol-5-yl]acetic acid;quinoline |
| PubChem CID | 162245224 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-[2-(2-hydroxyethyl)-1H-imidazol-5-yl]acetic acid;quinoline |
| SMILES | O=C(O)Cc1cnc(CCO)[nH]1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C7H10N2O3/c1-2-6-9-8(4-1)5-3-7-10-9;10-2-1-6-8-4-5(9-6)3-7(11)12/h1-7H;4,10H,1-3H2,(H,8,9)(H,11,12) |
| InChIKey | ZXFZSXBBLYPPMQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(2-hydroxyethyl)-1H-imidazol-5-yl]acetic acid;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-hydroxyethyl)-1H-imidazol-5-yl]acetic acid;quinoline?
The IUPAC name of 2-[2-(2-hydroxyethyl)-1H-imidazol-5-yl]acetic acid;quinoline (CID 162245224) is 2-[2-(2-hydroxyethyl)-1H-imidazol-5-yl]acetic acid;quinoline.
What is the SMILES notation for 2-[2-(2-hydroxyethyl)-1H-imidazol-5-yl]acetic acid;quinoline?
The canonical SMILES for 2-[2-(2-hydroxyethyl)-1H-imidazol-5-yl]acetic acid;quinoline is O=C(O)Cc1cnc(CCO)[nH]1.c1ccc2ncccc2c1.
What is the InChIKey of 2-[2-(2-hydroxyethyl)-1H-imidazol-5-yl]acetic acid;quinoline?
The InChIKey is ZXFZSXBBLYPPMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C7H10N2O3/c1-2-6-9-8(4-1)5-3-7-10-9;10-2-1-6-8-4-5(9-6)3-7(11)12/h1-7H;4,10H,1-3H2,(H,8,9)(H,11,12).
What are the key properties of 2-[2-(2-hydroxyethyl)-1H-imidazol-5-yl]acetic acid;quinoline?
2-[2-(2-hydroxyethyl)-1H-imidazol-5-yl]acetic acid;quinoline has a molecular weight of 299.33 g/mol, XLogP of 1.81, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-hydroxyethyl)-1H-imidazol-5-yl]acetic acid;quinoline is sourced from PubChem (CID 162245224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).