C17H20N+ — CID 162285104
1-methyl-2-(2-methylcyclopropyl)-4-[2-(trideuteriomethyl)phenyl]pyridin-1-ium (PubChem CID 162285104) has the molecular formula C17H20N+ and a molecular weight of 241.37 g/mol. Its IUPAC name is 1-methyl-2-(2-methylcyclopropyl)-4-[2-(trideuteriomethyl)phenyl]pyridin-1-ium.
| Compound Name | 1-methyl-2-(2-methylcyclopropyl)-4-[2-(trideuteriomethyl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 162285104 |
| Molecular Formula | C17H20N+ |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 1-methyl-2-(2-methylcyclopropyl)-4-[2-(trideuteriomethyl)phenyl]pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1ccccc1-c1cc[n+](C)c(C2CC2C)c1 |
| InChI | InChI=1S/C17H20N/c1-12-6-4-5-7-15(12)14-8-9-18(3)17(11-14)16-10-13(16)2/h4-9,11,13,16H,10H2,1-3H3/q+1/i1D3 |
| InChIKey | AFVMTDYQQNICGU-FIBGUPNXSA-N |
| XLogP | 3.61 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|