C18H25Cl3STi — CID 162285284
carbanide;3,4,5,6-tetramethyl-2-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophene;trichlorotitanium(1+) (PubChem CID 162285284) has the molecular formula C18H25Cl3STi and a molecular weight of 427.69 g/mol. Its IUPAC name is carbanide;3,4,5,6-tetramethyl-2-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophene;trichlorotitanium(1+).
| Compound Name | carbanide;3,4,5,6-tetramethyl-2-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophene;trichlorotitanium(1+) |
|---|---|
| PubChem CID | 162285284 |
| Molecular Formula | C18H25Cl3STi |
| Molecular Weight | 427.69 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | carbanide;3,4,5,6-tetramethyl-2-phenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]thiophene;trichlorotitanium(1+) |
| SMILES | CC1=C(c2ccccc2)SC2C(C)C(C)C(C)C12.Cl[Ti+](Cl)Cl.[CH3-] |
| InChI | InChI=1S/C17H22S.CH3.3ClH.Ti/c1-10-11(2)15-13(4)16(18-17(15)12(10)3)14-8-6-5-7-9-14;;;;;/h5-12,15,17H,1-4H3;1H3;3*1H;/q;-1;;;;+4/p-3 |
| InChIKey | KZOKMFGYDGBSOI-UHFFFAOYSA-K |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.69 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|