C38H62Si — CID 162291559
(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-(2,3,4,5,6,7-hexamethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane (PubChem CID 162291559) has the molecular formula C38H62Si and a molecular weight of 547.00 g/mol. Its IUPAC name is (2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-(2,3,4,5,6,7-hexamethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane.
| Compound Name | (2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-(2,3,4,5,6,7-hexamethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 162291559 |
| Molecular Formula | C38H62Si |
| Molecular Weight | 547.00 g/mol |
| Exact Mass | 546.46 |
| IUPAC Name | (2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-(2,3,4,5,6,7-hexamethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)-dimethylsilane |
| SMILES | CC1C(C)C(C)C2C(C1C)C(C)C(C)C2[Si](C)(C)C1C2C=C(C(C)(C)C)C=CC2C2C=CC(C(C)(C)C)=CC21 |
| InChI | InChI=1S/C38H62Si/c1-21-22(2)24(4)34-33(23(21)3)25(5)26(6)35(34)39(13,14)36-31-19-27(37(7,8)9)15-17-29(31)30-18-16-28(20-32(30)36)38(10,11)12/h15-26,29-36H,1-14H3 |
| InChIKey | KNTZBGOVJFWYJS-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.00 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|