C45H80 — CID 162298783
bis((3R,5S)-1,2,3,4,5-pentamethylcyclopentene);bis(prop-1-ene);(3S,5R)-1,2,3,4-tetramethyl-5-[[(1R,4S)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]methyl]cyclopentene (PubChem CID 162298783) has the molecular formula C45H80 and a molecular weight of 621.14 g/mol. Its IUPAC name is bis((3R,5S)-1,2,3,4,5-pentamethylcyclopentene);bis(prop-1-ene);(3S,5R)-1,2,3,4-tetramethyl-5-[[(1R,4S)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]methyl]cyclopentene.
| Compound Name | bis((3R,5S)-1,2,3,4,5-pentamethylcyclopentene);bis(prop-1-ene);(3S,5R)-1,2,3,4-tetramethyl-5-[[(1R,4S)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]methyl]cyclopentene |
|---|---|
| PubChem CID | 162298783 |
| Molecular Formula | C45H80 |
| Molecular Weight | 621.14 g/mol |
| Exact Mass | 620.63 |
| IUPAC Name | bis((3R,5S)-1,2,3,4,5-pentamethylcyclopentene);bis(prop-1-ene);(3S,5R)-1,2,3,4-tetramethyl-5-[[(1R,4S)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]methyl]cyclopentene |
| SMILES | C=CC.C=CC.CC1=C(C)[C@H](C)C(C)[C@@H]1C.CC1=C(C)[C@H](C)C(C)[C@@H]1C.CC1=C(C)[C@H](C[C@H]2C(C)=C(C)[C@@H](C)C2C)C(C)[C@@H]1C |
| InChI | InChI=1S/C19H32.2C10H18.2C3H6/c1-10-11(2)15(6)18(14(10)5)9-19-16(7)12(3)13(4)17(19)8;2*1-6-7(2)9(4)10(5)8(6)3;2*1-3-2/h10,12,14,16,18-19H,9H2,1-8H3;2*6-8H,1-5H3;2*3H,1H2,2H3/t10-,12-,14?,16?,18-,19-;2*6?,7-,8+;;/m1..../s1 |
| InChIKey | YDENZZOABUOROC-OHDNYPBJSA-N |
| XLogP | 14.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.14 |
| LogP ≤ 5 | 14.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|