C19H32 — CID 91386552
(3S,5R)-1,2,3,4-tetramethyl-5-[[(1R)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]methyl]cyclopentene (PubChem CID 91386552) has the molecular formula C19H32 and a molecular weight of 260.46 g/mol. Its IUPAC name is (3S,5R)-1,2,3,4-tetramethyl-5-[[(1R)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]methyl]cyclopentene.
| Compound Name | (3S,5R)-1,2,3,4-tetramethyl-5-[[(1R)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]methyl]cyclopentene |
|---|---|
| PubChem CID | 91386552 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | (3S,5R)-1,2,3,4-tetramethyl-5-[[(1R)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]methyl]cyclopentene |
| SMILES | CC1=C(C)[C@H](C[C@H]2C(C)=C(C)[C@@H](C)C2C)C(C)C1C |
| InChI | InChI=1S/C19H32/c1-10-11(2)15(6)18(14(10)5)9-19-16(7)12(3)13(4)17(19)8/h10,12,14,16,18-19H,9H2,1-8H3/t10-,12?,14?,16?,18-,19-/m1/s1 |
| InChIKey | STGFUWYBUHJWPJ-YLAYMJRHSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|