C10H18S — CID 142867217
2,3,4,5-tetramethylcyclohexene-1-thiol (PubChem CID 142867217) has the molecular formula C10H18S and a molecular weight of 170.32 g/mol. Its IUPAC name is 2,3,4,5-tetramethylcyclohexene-1-thiol.
| Compound Name | 2,3,4,5-tetramethylcyclohexene-1-thiol |
|---|---|
| PubChem CID | 142867217 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2,3,4,5-tetramethylcyclohexene-1-thiol |
| SMILES | CC1=C(S)CC(C)C(C)C1C |
| InChI | InChI=1S/C10H18S/c1-6-5-10(11)9(4)8(3)7(6)2/h6-8,11H,5H2,1-4H3 |
| InChIKey | WLFAAICZURRKSU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|