C10H18N2O4-2 — CID 163603149
N-[2-[hydroxy(oxido)amino]-3,4,5,6-tetramethylcyclohex-3-en-1-yl]-N-oxidohydroxylamine (PubChem CID 163603149) has the molecular formula C10H18N2O4-2 and a molecular weight of 230.26 g/mol. Its IUPAC name is N-[2-[hydroxy(oxido)amino]-3,4,5,6-tetramethylcyclohex-3-en-1-yl]-N-oxidohydroxylamine.
| Compound Name | N-[2-[hydroxy(oxido)amino]-3,4,5,6-tetramethylcyclohex-3-en-1-yl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 163603149 |
| Molecular Formula | C10H18N2O4-2 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | N-[2-[hydroxy(oxido)amino]-3,4,5,6-tetramethylcyclohex-3-en-1-yl]-N-oxidohydroxylamine |
| SMILES | CC1=C(C)C(N([O-])O)C(N([O-])O)C(C)C1C |
| InChI | InChI=1S/C10H18N2O4/c1-5-6(2)8(4)10(12(15)16)9(7(5)3)11(13)14/h5,7,9-10,13,15H,1-4H3/q-2 |
| InChIKey | AFHKOTSILTUJKI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|