C18H22N3O10S+ — CID 162325978
2-[(3-carbamoylpyridin-1-ium-1-yl)methoxycarbonylamino]-3-(3,4-dihydroxyphenyl)propanoic acid;methanesulfonic acid (PubChem CID 162325978) has the molecular formula C18H22N3O10S+ and a molecular weight of 472.45 g/mol. Its IUPAC name is 2-[(3-carbamoylpyridin-1-ium-1-yl)methoxycarbonylamino]-3-(3,4-dihydroxyphenyl)propanoic acid;methanesulfonic acid.
| Compound Name | 2-[(3-carbamoylpyridin-1-ium-1-yl)methoxycarbonylamino]-3-(3,4-dihydroxyphenyl)propanoic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 162325978 |
| Molecular Formula | C18H22N3O10S+ |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 2-[(3-carbamoylpyridin-1-ium-1-yl)methoxycarbonylamino]-3-(3,4-dihydroxyphenyl)propanoic acid;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.NC(=O)c1ccc[n+](COC(=O)NC(Cc2ccc(O)c(O)c2)C(=O)O)c1 |
| InChI | InChI=1S/C17H17N3O7.CH4O3S/c18-15(23)11-2-1-5-20(8-11)9-27-17(26)19-12(16(24)25)6-10-3-4-13(21)14(22)7-10;1-5(2,3)4/h1-5,7-8,12H,6,9H2,(H5-,18,19,21,22,23,24,25,26);1H3,(H,2,3,4)/p+1 |
| InChIKey | XQTSZAYJWFZNOX-UHFFFAOYSA-O |
| XLogP | -0.63 |
| TPSA | 217.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|