C18H28F3N3O9 — CID 162327660
N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-(2,5-dioxopyrrol-1-yl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 162327660) has the molecular formula C18H28F3N3O9 and a molecular weight of 487.43 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-(2,5-dioxopyrrol-1-yl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-(2,5-dioxopyrrol-1-yl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162327660 |
| Molecular Formula | C18H28F3N3O9 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-(2,5-dioxopyrrol-1-yl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | NCCOCCOCCOCCOCCNC(=O)CN1C(=O)C=CC1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H27N3O7.C2HF3O2/c17-3-5-23-7-9-25-11-12-26-10-8-24-6-4-18-14(20)13-19-15(21)1-2-16(19)22;3-2(4,5)1(6)7/h1-2H,3-13,17H2,(H,18,20);(H,6,7) |
| InChIKey | HDCIXFVSVVHHLQ-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 166.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|