C22H21N3O4 — CID 162345455
9-ethynyl-2,3-bis(2-methoxyethoxy)benzimidazolo[1,2-c]quinazoline (PubChem CID 162345455) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 9-ethynyl-2,3-bis(2-methoxyethoxy)benzimidazolo[1,2-c]quinazoline.
| Compound Name | 9-ethynyl-2,3-bis(2-methoxyethoxy)benzimidazolo[1,2-c]quinazoline |
|---|---|
| PubChem CID | 162345455 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 9-ethynyl-2,3-bis(2-methoxyethoxy)benzimidazolo[1,2-c]quinazoline |
| SMILES | C#Cc1ccc2nc3c4cc(OCCOC)c(OCCOC)cc4ncn3c2c1 |
| InChI | InChI=1S/C22H21N3O4/c1-4-15-5-6-17-19(11-15)25-14-23-18-13-21(29-10-8-27-3)20(28-9-7-26-2)12-16(18)22(25)24-17/h1,5-6,11-14H,7-10H2,2-3H3 |
| InChIKey | QPQHUPHEMYFGCL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|