C15H19N5O2 — CID 162381419
3-ethynyl-5-(methylamino)-1-[(3S,5S)-5-methyl-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-carboxamide (PubChem CID 162381419) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-ethynyl-5-(methylamino)-1-[(3S,5S)-5-methyl-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 3-ethynyl-5-(methylamino)-1-[(3S,5S)-5-methyl-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162381419 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 3-ethynyl-5-(methylamino)-1-[(3S,5S)-5-methyl-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-carboxamide |
| SMILES | C#Cc1nn([C@H]2C[C@H](C)N(C(=O)C=C)C2)c(NC)c1C(N)=O |
| InChI | InChI=1S/C15H19N5O2/c1-5-11-13(14(16)22)15(17-4)20(18-11)10-7-9(3)19(8-10)12(21)6-2/h1,6,9-10,17H,2,7-8H2,3-4H3,(H2,16,22)/t9-,10-/m0/s1 |
| InChIKey | YGLWZYPZVCEFER-UWVGGRQHSA-N |
| XLogP | 0.35 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|