C13H13BBrNO5 — CID 162407421
2-[(1R)-1-bromo-2-oxo-2-phenylethyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 162407421) has the molecular formula C13H13BBrNO5 and a molecular weight of 353.97 g/mol. Its IUPAC name is 2-[(1R)-1-bromo-2-oxo-2-phenylethyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 2-[(1R)-1-bromo-2-oxo-2-phenylethyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 162407421 |
| Molecular Formula | C13H13BBrNO5 |
| Molecular Weight | 353.97 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 2-[(1R)-1-bromo-2-oxo-2-phenylethyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | CN1CC(=O)OB([C@@H](Br)C(=O)c2ccccc2)OC(=O)C1 |
| InChI | InChI=1S/C13H13BBrNO5/c1-16-7-10(17)20-14(21-11(18)8-16)13(15)12(19)9-5-3-2-4-6-9/h2-6,13H,7-8H2,1H3/t13-/m0/s1 |
| InChIKey | SAVCXJACMYOUEW-ZDUSSCGKSA-N |
| XLogP | 0.69 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.97 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|