C18H17FINO2S — CID 162411534
(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-iodo-1,2,3,3a,4,5-hexahydrobenzo[e]indole (PubChem CID 162411534) has the molecular formula C18H17FINO2S and a molecular weight of 457.31 g/mol. Its IUPAC name is (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-iodo-1,2,3,3a,4,5-hexahydrobenzo[e]indole.
| Compound Name | (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-iodo-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
|---|---|
| PubChem CID | 162411534 |
| Molecular Formula | C18H17FINO2S |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 457.00 |
| IUPAC Name | (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-iodo-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
| SMILES | O=S(=O)(c1ccc(F)cc1)[C@@]12CCN[C@@H]1CCc1cc(I)ccc12 |
| InChI | InChI=1S/C18H17FINO2S/c19-13-2-5-15(6-3-13)24(22,23)18-9-10-21-17(18)8-1-12-11-14(20)4-7-16(12)18/h2-7,11,17,21H,1,8-10H2/t17-,18-/m1/s1 |
| InChIKey | OFYJRYCLKITWES-QZTJIDSGSA-N |
| XLogP | 3.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|