C31H46FNO5Si — CID 162461595
dipropan-2-yl 2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-(4-fluoro-3,5-dimethylphenyl)anilino]propanedioate (PubChem CID 162461595) has the molecular formula C31H46FNO5Si and a molecular weight of 559.80 g/mol. Its IUPAC name is dipropan-2-yl 2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-(4-fluoro-3,5-dimethylphenyl)anilino]propanedioate.
| Compound Name | dipropan-2-yl 2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-(4-fluoro-3,5-dimethylphenyl)anilino]propanedioate |
|---|---|
| PubChem CID | 162461595 |
| Molecular Formula | C31H46FNO5Si |
| Molecular Weight | 559.80 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | dipropan-2-yl 2-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-(4-fluoro-3,5-dimethylphenyl)anilino]propanedioate |
| SMILES | Cc1cc(N(c2ccc(CCO[Si](C)(C)C(C)(C)C)cc2)C(C(=O)OC(C)C)C(=O)OC(C)C)cc(C)c1F |
| InChI | InChI=1S/C31H46FNO5Si/c1-20(2)37-29(34)28(30(35)38-21(3)4)33(26-18-22(5)27(32)23(6)19-26)25-14-12-24(13-15-25)16-17-36-39(10,11)31(7,8)9/h12-15,18-21,28H,16-17H2,1-11H3 |
| InChIKey | UOVKDQQRQPBYED-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.80 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|