C21H27N6O15P — CID 162466640
2-[3-[3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-7-nitro-4-oxopyrazolo[4,5-d]triazin-5-yl]-2-diethoxyphosphorylacetic acid (PubChem CID 162466640) has the molecular formula C21H27N6O15P and a molecular weight of 634.45 g/mol. Its IUPAC name is 2-[3-[3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-7-nitro-4-oxopyrazolo[4,5-d]triazin-5-yl]-2-diethoxyphosphorylacetic acid.
| Compound Name | 2-[3-[3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-7-nitro-4-oxopyrazolo[4,5-d]triazin-5-yl]-2-diethoxyphosphorylacetic acid |
|---|---|
| PubChem CID | 162466640 |
| Molecular Formula | C21H27N6O15P |
| Molecular Weight | 634.45 g/mol |
| Exact Mass | 634.13 |
| IUPAC Name | 2-[3-[3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-7-nitro-4-oxopyrazolo[4,5-d]triazin-5-yl]-2-diethoxyphosphorylacetic acid |
| SMILES | CCOP(=O)(OCC)C(C(=O)O)n1nc([N+](=O)[O-])c2nnn(C3OC(COC(C)=O)C(OC(C)=O)C3OC(C)=O)c(=O)c21 |
| InChI | InChI=1S/C21H27N6O15P/c1-6-38-43(36,39-7-2)20(21(32)33)25-14-13(17(23-25)27(34)35)22-24-26(18(14)31)19-16(41-11(5)30)15(40-10(4)29)12(42-19)8-37-9(3)28/h12,15-16,19-20H,6-8H2,1-5H3,(H,32,33) |
| InChIKey | WCJDVGGHGOVFHB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 269.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.45 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|