C31H33F9N4O3S — CID 162538334
(3R,7S)-3,7-dimethyl-1-[[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenyl]methoxy]-8-(1-phenyltetrazol-5-yl)sulfanyloct-5-yn-4-ol (PubChem CID 162538334) has the molecular formula C31H33F9N4O3S and a molecular weight of 712.68 g/mol. Its IUPAC name is (3R,7S)-3,7-dimethyl-1-[[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenyl]methoxy]-8-(1-phenyltetrazol-5-yl)sulfanyloct-5-yn-4-ol.
| Compound Name | (3R,7S)-3,7-dimethyl-1-[[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenyl]methoxy]-8-(1-phenyltetrazol-5-yl)sulfanyloct-5-yn-4-ol |
|---|---|
| PubChem CID | 162538334 |
| Molecular Formula | C31H33F9N4O3S |
| Molecular Weight | 712.68 g/mol |
| Exact Mass | 712.21 |
| IUPAC Name | (3R,7S)-3,7-dimethyl-1-[[4-(4,4,5,5,6,6,7,7,7-nonafluoroheptoxy)phenyl]methoxy]-8-(1-phenyltetrazol-5-yl)sulfanyloct-5-yn-4-ol |
| SMILES | C[C@H](CCOCc1ccc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)C(O)C#C[C@H](C)CSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C31H33F9N4O3S/c1-21(20-48-27-41-42-43-44(27)24-7-4-3-5-8-24)9-14-26(45)22(2)15-18-46-19-23-10-12-25(13-11-23)47-17-6-16-28(32,33)29(34,35)30(36,37)31(38,39)40/h3-5,7-8,10-13,21-22,26,45H,6,15-20H2,1-2H3/t21-,22+,26?/m0/s1 |
| InChIKey | YPJHGPGCOYTNOL-SMWUWQHRSA-N |
| XLogP | 7.62 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.68 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|