C22H25F5O2 — CID 162541360
(8S,13S,14S)-13-ethyl-17-hydroxy-7-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 162541360) has the molecular formula C22H25F5O2 and a molecular weight of 416.43 g/mol. Its IUPAC name is (8S,13S,14S)-13-ethyl-17-hydroxy-7-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,13S,14S)-13-ethyl-17-hydroxy-7-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 162541360 |
| Molecular Formula | C22H25F5O2 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (8S,13S,14S)-13-ethyl-17-hydroxy-7-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC[C@]12C=CC3=C4CCC(=O)C=C4CC(C)[C@H]3[C@@H]1CCC2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H25F5O2/c1-3-19-8-6-16-15-5-4-14(28)11-13(15)10-12(2)18(16)17(19)7-9-20(19,29)21(23,24)22(25,26)27/h6,8,11-12,17-18,29H,3-5,7,9-10H2,1-2H3/t12?,17-,18+,19-,20?/m0/s1 |
| InChIKey | XTWAUXJJCCOCTR-CZQAQVTCSA-N |
| XLogP | 5.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|