C29H21F5N4O2 — CID 162574532
N-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]cyclohexa-1,3-dien-1-yl]-3-phenylbenzamide (PubChem CID 162574532) has the molecular formula C29H21F5N4O2 and a molecular weight of 552.50 g/mol. Its IUPAC name is N-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]cyclohexa-1,3-dien-1-yl]-3-phenylbenzamide.
| Compound Name | N-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]cyclohexa-1,3-dien-1-yl]-3-phenylbenzamide |
|---|---|
| PubChem CID | 162574532 |
| Molecular Formula | C29H21F5N4O2 |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | N-[4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]cyclohexa-1,3-dien-1-yl]-3-phenylbenzamide |
| SMILES | O=C(NC1=CC=C(c2ncn(-c3ccc(OC(F)(F)C(F)(F)F)cc3)n2)CC1)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C29H21F5N4O2/c30-28(31,32)29(33,34)40-25-15-13-24(14-16-25)38-18-35-26(37-38)20-9-11-23(12-10-20)36-27(39)22-8-4-7-21(17-22)19-5-2-1-3-6-19/h1-9,11,13-18H,10,12H2,(H,36,39) |
| InChIKey | YWDFPJDUFHEHCV-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|